4-Isopropylbenzeneboronic acid
- Product Name4-Isopropylbenzeneboronic acid
- CAS16152-51-5
- MFC9H13BO2
- MW164.01
- EINECS
- MOL File16152-51-5.mol
Chemical Properties
| Melting point | 110-112°C |
| Boiling point | 285.9±33.0 °C(Predicted) |
| Density | 1.04±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 8.83±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 2830262 |
| InChI | InChI=1S/C9H13BO2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h3-7,11-12H,1-2H3 |
| InChIKey | IAEUFBDMVKQCLU-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C(C)C)C=C1)(O)O |
| CAS DataBase Reference | 16152-51-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-43-22 |
| Safety Statements | 26-36/37/39-36/37-36 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
