14660-52-7
| Name | Ethyl 5-bromovalerate |
| CAS | 14660-52-7 |
| EINECS(EC#) | 238-705-2 |
| Molecular Formula | C7H13BrO2 |
| MDL Number | MFCD00000266 |
| Molecular Weight | 209.08 |
| MOL File | 14660-52-7.mol |
Chemical Properties
| Appearance | clear colorless to pale yellow liquid |
| Boiling point | 104-109 °C/12 mmHg (lit.) |
| density | 1.321 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 219 °F |
| storage temp. | Store at RT. |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Clear colorless to pale yellow |
| Water Solubility | Not miscible or difficult to mix in water. |
| Sensitive | Light Sensitive |
| BRN | 1752023 |
| InChI | InChI=1S/C7H13BrO2/c1-2-10-7(9)5-3-4-6-8/h2-6H2,1H3 |
| InChIKey | AFRWBGJRWRHQOV-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)CCCCBr |
| CAS DataBase Reference | 14660-52-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Pentanoic acid, 5-bromo-, ethyl ester(14660-52-7) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 8-10 |
| HS Code | 29159000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |