
136030-00-7
| Name | (1R,2S)-1-Amino-2-indanol |
| CAS | 136030-00-7 |
| EINECS(EC#) | 603-940-5 |
| Molecular Formula | C9H11NO |
| MDL Number | MFCD00216656 |
| Molecular Weight | 149.19 |
| MOL File | 136030-00-7.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 118-121 °C(lit.) |
| alpha | 44.5 º (c=1, methanol) |
| Boiling point | 270.27°C (rough estimate) |
| density | 1.0753 (rough estimate) |
| refractive index | 43 ° (C=1, MeOH) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | Powder |
| pka | 14.79±0.40(Predicted) |
| color | White to light beige |
| Optical Rotation | [α]22/D +63°, c = 0.2 in chloroform |
| Water Solubility | soluble |
| BRN | 2803743 |
| InChI | InChI=1S/C9H11NO/c10-9-7-4-2-1-3-6(7)5-8(9)11/h1-4,8-9,11H,5,10H2/t8-,9+/m0/s1 |
| InChIKey | LOPKSXMQWBYUOI-DTWKUNHWSA-N |
| SMILES | [C@@H]1(N)C2=C(C=CC=C2)C[C@@H]1O |
| CAS DataBase Reference | 136030-00-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 3 |
| F | 10-23 |
| TSCA | No |
| HS Code | 29061990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
