133115-72-7
| Name | 4-(Trifluoromethoxy)phenylhydrazine hydrochloride |
| CAS | 133115-72-7 |
| EINECS(EC#) | 236-341-9 |
| Molecular Formula | C7H8ClF3N2O |
| MDL Number | MFCD00053033 |
| Molecular Weight | 228.6 |
| MOL File | 133115-72-7.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 230 °C(lit.) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| Water Solubility | Soluble in water |
| form | Powder |
| color | White to pale brown |
| InChI | InChI=1S/C7H7F3N2O.ClH/c8-7(9,10)13-6-3-1-5(12-11)2-4-6;/h1-4,12H,11H2;1H |
| InChIKey | KQXZVSQCMVKMBK-UHFFFAOYSA-N |
| SMILES | C1(OC(F)(F)F)C=CC(NN)=CC=1.Cl |
| CAS DataBase Reference | 133115-72-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |