13080-85-8
| Name | 4,4'-Bis(4-aminophenoxy)biphenyl |
| CAS | 13080-85-8 |
| EINECS(EC#) | 627-298-0 |
| Molecular Formula | C24H20N2O2 |
| MDL Number | MFCD00039151 |
| Molecular Weight | 368.43 |
| MOL File | 13080-85-8.mol |
Chemical Properties
| Melting point | 197-200 °C(lit.) |
| Boiling point | 571.4±50.0 °C(Predicted) |
| density | 1.226±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO: 74 mg/mL (200.85 mM);; |
| form | powder to crystal |
| pka | 5.10±0.10(Predicted) |
| color | White to Gray to Red |
| InChI | InChI=1S/C24H20N2O2/c25-19-5-13-23(14-6-19)27-21-9-1-17(2-10-21)18-3-11-22(12-4-18)28-24-15-7-20(26)8-16-24/h1-16H,25-26H2 |
| InChIKey | HYDATEKARGDBKU-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(OC3=CC=C(N)C=C3)C=C2)=CC=C(OC2=CC=C(N)C=C2)C=C1 |
| CAS DataBase Reference | 13080-85-8(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29222990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |