621-95-4
| Name | 4,4'-Ethylenedianiline |
| CAS | 621-95-4 |
| EINECS(EC#) | 210-716-7 |
| Molecular Formula | C14H16N2 |
| MDL Number | MFCD00007923 |
| Molecular Weight | 212.29 |
| MOL File | 621-95-4.mol |
Chemical Properties
| Appearance | Beige powder |
| Melting point | 133-137 °C(lit.) |
| Boiling point | 342.14°C (rough estimate) |
| density | 0.9678 (rough estimate) |
| vapor pressure | 0.001Pa at 20℃ |
| refractive index | 1.4400 (estimate) |
| storage temp. | room temp |
| form | Powder |
| pka | 5.17±0.10(Predicted) |
| color | White to Gray to Brown |
| BRN | 394999 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C14H16N2/c15-13-7-3-11(4-8-13)1-2-12-5-9-14(16)10-6-12/h3-10H,1-2,15-16H2 |
| InChIKey | UHNUHZHQLCGZDA-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(N)C=C1)CC1=CC=C(N)C=C1 |
| LogP | 2.25 at 23℃ and pH7.7-8.6 |
| CAS DataBase Reference | 621-95-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 4,4'-(1,2-ethanediyl)bis-(621-95-4) |
| EPA Substance Registry System | 621-95-4(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| RTECS | BY0200000 |
| TSCA | TSCA listed |
| HS Code | 2921.59.8090 |
| REACH Registrations | Active |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |