139-59-3
| Name | 4-Phenoxyaniline |
| CAS | 139-59-3 |
| EINECS(EC#) | 205-367-2 |
| Molecular Formula | C12H11NO |
| MDL Number | MFCD00007862 |
| Molecular Weight | 185.22 |
| MOL File | 139-59-3.mol |
Chemical Properties
| Appearance | brown to green-brown crystalline flakes or powder |
| Melting point | 82-84 °C(lit.) |
| Boiling point | 140 °C (2.2503 mmHg) |
| density | 1.0936 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | RT, protect from light |
| form | Crystalline Flakes or Powder |
| pka | 4.75±0.10(Predicted) |
| color | Brown to green-brown |
| Water Solubility | < 1 g/L (20 ºC) |
| BRN | 777708 |
| InChI | InChI=1S/C12H11NO/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-9H,13H2 |
| InChIKey | WOYZXEVUWXQVNV-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(OC2=CC=CC=C2)C=C1 |
| CAS DataBase Reference | 139-59-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 4-phenoxy-(139-59-3) |
| EPA Substance Registry System | 139-59-3(EPA Substance) |
Safety Data
| Symbol(GHS) |     GHS06,GHS08,GHS09,GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319-H335-H301-H341-H400-H410 |
| Precautionary statements | P261-P280-P305+P351+P338-P201-P301+P310a-P405-P501a |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | BY7930000 |
| F | 9 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HazardClass | 9 |
| HazardClass | IRRITANT |
| HS Code | 29222990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| Toxicity |