
2479-46-1
| Name | 4,4'-(1,3-Phenylenedioxy)dianiline |
| CAS | 2479-46-1 |
| EINECS(EC#) | 628-902-5 |
| Molecular Formula | C18H16N2O2 |
| MDL Number | MFCD00039154 |
| Molecular Weight | 292.33 |
| MOL File | 2479-46-1.mol |
Chemical Properties
| Melting point | 115-118 °C(lit.) |
| Boiling point | 434.27°C (rough estimate) |
| density | 1.1925 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | very faint turbidity in Acetonitrile |
| form | powder to crystal |
| pka | 5.06±0.10(Predicted) |
| color | White to Brown |
| InChI | InChI=1S/C18H16N2O2/c19-13-4-8-15(9-5-13)21-17-2-1-3-18(12-17)22-16-10-6-14(20)7-11-16/h1-12H,19-20H2 |
| InChIKey | WUPRYUDHUFLKFL-UHFFFAOYSA-N |
| SMILES | C1(OC2=CC=C(N)C=C2)=CC=CC(OC2=CC=C(N)C=C2)=C1 |
| CAS DataBase Reference | 2479-46-1(CAS DataBase Reference) |
| EPA Substance Registry System | 2479-46-1(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | BY8236000 |
| TSCA | TSCA listed |
| HS Code | 29222990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
