128143-88-4
| Name | 2,6-BIS(2-PYRIDYL)-4(1H)-PYRIDONE |
| CAS | 128143-88-4 |
| Molecular Formula | C15H11N3O |
| MDL Number | MFCD01321386 |
| Molecular Weight | 249.27 |
| MOL File | 128143-88-4.mol |
Chemical Properties
| Melting point | 168-170 °C(lit.) |
| Boiling point | 505.5±50.0 °C(Predicted) |
| density | 1.269±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | -0.16±0.69(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C15H11N3O/c19-11-9-14(12-5-1-3-7-16-12)18-15(10-11)13-6-2-4-8-17-13/h1-10H,(H,18,19) |
| InChIKey | HRORSVNZQWCZTD-UHFFFAOYSA-N |
| SMILES | C1(C2NC(C3=NC=CC=C3)=CC(=O)C=2)=NC=CC=C1 |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |