1762-34-1
| Name | 5,5'-DIMETHYL-2,2'-DIPYRIDYL |
| CAS | 1762-34-1 |
| Molecular Formula | C12H12N2 |
| MDL Number | MFCD01740554 |
| Molecular Weight | 184.24 |
| MOL File | 1762-34-1.mol |
Chemical Properties
| Melting point | 114-117 °C(lit.) |
| Boiling point | 140℃/3mm |
| density | 1.060±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMF: 15mg/mL,DMSO: 10mg/mL,Ethanol: 15mg/mL,Ethanol:PBS (pH 7.2) (1:4): 0.2mg/mL |
| form | powder to crystal |
| pka | 4.78±0.32(Predicted) |
| color | White to Yellow to Orange |
| InChI | InChI=1S/C12H12N2/c1-9-3-5-11(13-7-9)12-6-4-10(2)8-14-12/h3-8H,1-2H3 |
| InChIKey | PTRATZCAGVBFIQ-UHFFFAOYSA-N |
| SMILES | C1(C2=NC=C(C)C=C2)=NC=C(C)C=C1 |
| CAS DataBase Reference | 1762-34-1(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | DW1766000 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity |
