4411-80-7
| Name | 6,6'-Dimethyl-2,2'-dipyridyl |
| CAS | 4411-80-7 |
| EINECS(EC#) | 224-566-5 |
| Molecular Formula | C12H12N2 |
| MDL Number | MFCD00059776 |
| Molecular Weight | 184.24 |
| MOL File | 4411-80-7.mol |
Chemical Properties
| Melting point | 93-95 °C(lit.) |
| Boiling point | 286 °C |
| density | 1.060±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in Methanol |
| form | powder to crystaline |
| pka | 5.20±0.22(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C12H12N2/c1-9-5-3-7-11(13-9)12-8-4-6-10(2)14-12/h3-8H,1-2H3 |
| InChIKey | OHJPGUSXUGHOGE-UHFFFAOYSA-N |
| SMILES | C1(C2=NC(C)=CC=C2)=NC(C)=CC=C1 |
| CAS DataBase Reference | 4411-80-7(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | DW1767000 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |