
17217-57-1
| Name | 4,4'-DIMETHOXY-2,2'-BIPYRIDINE |
| CAS | 17217-57-1 |
| EINECS(EC#) | 628-568-0 |
| Molecular Formula | C12H12N2O2 |
| MDL Number | MFCD00233880 |
| Molecular Weight | 216.24 |
| MOL File | 17217-57-1.mol |
Chemical Properties
| Appearance | white to light yellow-beige crystalline powder |
| Melting point | 168-171 °C(lit.) |
| Boiling point | 347.6±37.0℃ (760 Torr) |
| density | 1.143±0.06 g/cm3 (20 ºC 760 Torr) |
| refractive index | 1.6660 (estimate) |
| Fp | 127.0±16.8℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 5.69±0.30(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C12H12N2O2/c1-15-9-3-5-13-11(7-9)12-8-10(16-2)4-6-14-12/h3-8H,1-2H3 |
| InChIKey | IMEVSAIFJKKDAP-UHFFFAOYSA-N |
| SMILES | C1(C2=NC=CC(OC)=C2)=NC=CC(OC)=C1 |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
