127946-77-4
| Name | 1-Amino-1-cyclopropanecarbonitrile hydrochloride |
| CAS | 127946-77-4 |
| EINECS(EC#) | 629-718-8 |
| Molecular Formula | C4H7ClN2 |
| MDL Number | MFCD04114063 |
| Molecular Weight | 118.56 |
| MOL File | 127946-77-4.mol |
Chemical Properties
| Melting point | 223°C |
| density | 1.244 at 20℃ |
| vapor pressure | 1.475hPa at 20℃ |
| storage temp. | Store at 0-5°C |
| Water Solubility | Soluble in water |
| form | Powder |
| color | White to Almost white |
| InChI | InChI=1S/C4H6N2.ClH/c5-3-4(6)1-2-4;/h1-2,6H2;1H |
| InChIKey | PCEIEQLJYDMRFZ-UHFFFAOYSA-N |
| SMILES | C1(N)(CC1)C#N.Cl |
| LogP | 2.72 at 25℃ and pH5.5 |
| CAS DataBase Reference | 127946-77-4(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H317-H319 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN3439 |
| WGK Germany | 3 |
| REACH Registrations | Active |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Sens. 1 |