118-31-0
| Name | 1-NAPHTHALENEMETHYLAMINE |
| CAS | 118-31-0 |
| EINECS(EC#) | 204-244-0 |
| Molecular Formula | C11H11N |
| MDL Number | MFCD00004048 |
| Molecular Weight | 157.21 |
| MOL File | 118-31-0.mol |
Chemical Properties
| Appearance | Clear light yellow to yellow liquid |
| Melting point | 262-269 °C |
| Boiling point | 290-293 °C (lit.) |
| density | 1.073 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Miscible with ethanol, ether and carbon disulfide. |
| form | Liquid |
| pka | 9.06±0.30(Predicted) |
| color | Clear light yellow to yellow |
| Sensitive | Air Sensitive |
| Detection Methods | HPLC,NMR,GC |
| BRN | 2206459 |
| InChI | InChI=1S/C11H11N/c12-8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8,12H2 |
| InChIKey | NVSYANRBXPURRQ-UHFFFAOYSA-N |
| SMILES | C1(CN)=C2C(C=CC=C2)=CC=C1 |
| CAS DataBase Reference | 118-31-0(CAS DataBase Reference) |
| Storage Precautions | Store under nitrogen |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2735 |
| WGK Germany | 3 |
| F | 10-34 |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29214990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |