114214-69-6
| Name | 1-Boc-3-hydroxymethylpyrrolidine |
| CAS | 114214-69-6 |
| Molecular Formula | C10H19NO3 |
| MDL Number | MFCD02179040 |
| Molecular Weight | 201.26 |
| MOL File | 114214-69-6.mol |
Chemical Properties
| Boiling point | 285-291℃ |
| density | 1.089 |
| refractive index | 1.4680 to 1.4720 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| pka | 14.93±0.10(Predicted) |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C10H19NO3/c1-10(2,3)14-9(13)11-5-4-8(6-11)7-12/h8,12H,4-7H2,1-3H3 |
| InChIKey | HKIGXXRMJFUUKV-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC(CO)C1 |
| CAS DataBase Reference | 114214-69-6(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H410 |
| Precautionary statements | P264-P270-P273-P301+P310-P391-P405 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 2933998090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 |
