
112275-50-0
| Name | 1-Boc-hexahydro-1,4-diazepine |
| CAS | 112275-50-0 |
| EINECS(EC#) | 628-955-4 |
| Molecular Formula | C10H20N2O2 |
| MDL Number | MFCD00276987 |
| Molecular Weight | 200.28 |
| MOL File | 112275-50-0.mol |
Chemical Properties
| Melting point | 143.4 °C |
| Boiling point | 95-110 °C0.5 mm Hg(lit.) |
| density | 1.016 g/mL at 20 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Keep Cold |
| form | Liquid |
| pka | 10.45±0.20(Predicted) |
| color | Colorless to yellow |
| Specific Gravity | 1.016 |
| Water Solubility | Not miscible or difficult to mix in water. |
| Sensitive | Air Sensitive |
| Detection Methods | GC,NMR,MS |
| BRN | 7581789 |
| InChI | InChI=1S/C10H20N2O2/c1-10(2,3)14-9(13)12-7-4-5-11-6-8-12/h11H,4-8H2,1-3H3 |
| InChIKey | WDPWEXWMQDRXAL-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCCNCC1 |
| CAS DataBase Reference | 112275-50-0(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2735 |
| WGK Germany | 3 |
| F | 10-34 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| HazardClass | IRRITANT, KEEP COLD |
| HS Code | 29339900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
