1071-46-1
| Name | Ethyl hydrogen malonate |
| CAS | 1071-46-1 |
| EINECS(EC#) | 213-992-7 |
| Molecular Formula | C5H8O4 |
| MDL Number | MFCD00020490 |
| Molecular Weight | 132.11 |
| MOL File | 1071-46-1.mol |
Chemical Properties
| Melting point | -13°C(lit.) |
| Boiling point | 106.5 °C/3 mmHg (lit.) |
| density | 1.119 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly) |
| form | Liquid |
| pka | pK1:3.55 (25°C) |
| color | Pale yellow |
| Water Solubility | Miscible with water, chloroform and other solvents. |
| BRN | 1758845 |
| InChI | InChI=1S/C5H8O4/c1-2-9-5(8)3-4(6)7/h2-3H2,1H3,(H,6,7) |
| InChIKey | HGINADPHJQTSKN-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)CC(O)=O |
| CAS DataBase Reference | 1071-46-1(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| REACH Registrations | Active |
| HS Code | 29171900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |