
101-10-0
| Name | 2-(3-Chlorophenoxy)-propionic acid |
| CAS | 101-10-0 |
| EINECS(EC#) | 202-915-2 |
| Molecular Formula | C9H9ClO3 |
| MDL Number | MFCD00009723 |
| Molecular Weight | 200.62 |
| MOL File | 101-10-0.mol |
Chemical Properties
| Appearance | white to off-white crystalline powder |
| Melting point | 113-115 °C (lit.) |
| Boiling point | 288.02°C (rough estimate) |
| density | 1.2799 (rough estimate) |
| refractive index | 1.5230 (estimate) |
| storage temp. | 0-6°C |
| form | powder to crystal |
| pka | 3.13±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| BRN | 1876444 |
| InChI | InChI=1S/C9H9ClO3/c1-6(9(11)12)13-8-4-2-3-7(10)5-8/h2-6H,1H3,(H,11,12) |
| InChIKey | YNTJKQDWYXUTLZ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(OC1=CC=CC(Cl)=C1)C |
| CAS DataBase Reference | 101-10-0(CAS DataBase Reference) |
| EPA Substance Registry System | 101-10-0(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| RTECS | UE9285000 |
| TSCA | TSCA listed |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 101-10-0(Hazardous Substances Data) |
| Toxicity |
