25122-46-7
| Name | Clobetasol propionate |
| CAS | 25122-46-7 |
| EINECS(EC#) | 246-634-3 |
| Molecular Formula | C25H32ClFO5 |
| MDL Number | MFCD00058499 |
| Molecular Weight | 466.97 |
| MOL File | 25122-46-7.mol |
Chemical Properties
| Appearance | White Crystalline Powder |
| Melting point | 195.5-1970C |
| alpha | D +103.8° (c = 1.04 in dioxane) |
| Boiling point | 569.0±50.0 °C(Predicted) |
| density | 1.1653 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| solubility | Practically insoluble in water, freely soluble in acetone, sparingly soluble in ethanol (96 per cent). |
| form | neat |
| pka | 12.88±0.70(Predicted) |
| color | White to off-white |
| Usage | Topical corticosteroid. Glucocorticoid; anti-inflammatory |
| Major Application | forensics and toxicology veterinary |
| InChIKey | CBGUOGMQLZIXBE-XGQKBEPLSA-N |
| SMILES | O([C@@]1([C@H](C[C@@]2([H])[C@]3([H])CCC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]12C)C)C(=O)CCl)C(=O)CC |&1:1,2,4,6,16,18,20,23,r| |
| CAS DataBase Reference | 25122-46-7(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| RTECS | TU3725000 |
| HS Code | 29372200 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Chronic 4 Repr. 1B STOT RE 2 |
