100784-20-1
| Name | Halosulfuron methyl |
| CAS | 100784-20-1 |
| EINECS(EC#) | 600-130-3 |
| Molecular Formula | C13H15ClN6O7S |
| MDL Number | MFCD01631160 |
| Molecular Weight | 434.81 |
| MOL File | 100784-20-1.mol |
Chemical Properties
| Melting point | 175-177°C |
| density | 1.618 |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), Methanol (Slightly, Heated) |
| Water Solubility | Insoluble in water |
| form | neat |
| pka | 11.96±0.70(Predicted) |
| color | White to Light yellow to Light orange |
| Merck | 14,4602 |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C13H15ClN6O7S/c1-20-10(8(9(14)18-20)11(21)27-4)28(23,24)19-13(22)17-12-15-6(25-2)5-7(16-12)26-3/h5H,1-4H3,(H2,15,16,17,19,22) |
| InChIKey | FMGZEUWROYGLAY-UHFFFAOYSA-N |
| SMILES | N1(C)C(S(NC(NC2=NC(OC)=CC(OC)=N2)=O)(=O)=O)=C(C(OC)=O)C(Cl)=N1 |
| CAS DataBase Reference | 100784-20-1(CAS DataBase Reference) |
| EPA Substance Registry System | 100784-20-1(EPA Substance) |
Safety Data
| Hazard Codes | N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | UQ6392606 |
| HS Code | 2935.90.9500 |
| HazardClass | 9 |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Repr. 1B |
| Toxicity |