1006-41-3
| Name | 2-Bromo-4-fluorobenzoic acid |
| CAS | 1006-41-3 |
| EINECS(EC#) | 600-118-8 |
| Molecular Formula | C7H4BrFO2 |
| MDL Number | MFCD00055370 |
| Molecular Weight | 219.01 |
| MOL File | 1006-41-3.mol |
Chemical Properties
| Appearance | white fine powder |
| Melting point | 172-176 °C (lit.) |
| Boiling point | 294.3±25.0 °C(Predicted) |
| density | 1.7218 (rough estimate) |
| refractive index | 1.4240 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 2.79±0.10(Predicted) |
| color | White to Almost white |
| Water Solubility | Soluble in water and methanol. |
| BRN | 2614292 |
| InChI | InChI=1S/C7H4BrFO2/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3H,(H,10,11) |
| InChIKey | RRKPMLZRLKTDQV-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(F)C=C1Br |
| CAS DataBase Reference | 1006-41-3(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |