
1007-16-5
| Name | 3-Bromo-4-fluorobenzoic acid |
| CAS | 1007-16-5 |
| EINECS(EC#) | 213-751-6 |
| Molecular Formula | C7H4BrFO2 |
| MDL Number | MFCD00042463 |
| Molecular Weight | 219.01 |
| MOL File | 1007-16-5.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 138-140 °C (lit.) |
| Boiling point | 306.6±27.0 °C(Predicted) |
| density | 1.789±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| pka | 3.75±0.10(Predicted) |
| color | White to slightly beige |
| InChI | InChI=1S/C7H4BrFO2/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,(H,10,11) |
| InChIKey | ONELILMJNOWXSA-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(F)C(Br)=C1 |
| CAS DataBase Reference | 1007-16-5(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 3-bromo-4-fluoro- (1007-16-5) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
