496-69-5
| Name | 2-Bromo-4-fluorophenol |
| CAS | 496-69-5 |
| Molecular Formula | C6H4BrFO |
| MDL Number | MFCD00010614 |
| Molecular Weight | 191 |
| MOL File | 496-69-5.mol |
Chemical Properties
| Appearance | light brown to brown crystalline solid |
| Melting point | 43-45 °C (lit.) |
| Boiling point | 89 °C/1 mmHg (lit.) |
| density | 1.744 |
| refractive index | 1.554 |
| Fp | 185 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Crystalline Solid |
| pka | 8.44±0.18(Predicted) |
| color | Light brown to brown |
| BRN | 2355593 |
| InChI | InChI=1S/C6H4BrFO/c7-5-3-4(8)1-2-6(5)9/h1-3,9H |
| InChIKey | MEYRABVEYCFHHB-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(F)C=C1Br |
| CAS DataBase Reference | 496-69-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H228-H302+H312+H332-H302-H315-H319-H335 |
| Precautionary statements | P210-P240-P241-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501-P261-P305+P351+P338-P280a-P304+P340-P405-P501a |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| REACH Registrations | Inactive |
| PackingGroup | III |
| HS Code | 29071990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
