| Melting point |
233 °C (dec.)(lit.) |
| alpha |
D27 -90.3° (c = 0.288 in methanol) |
| Boiling point |
695.91°C (rough estimate) |
| Density |
1.1340 (rough estimate) |
| refractive index |
1.7500 (estimate) |
| storage temp. |
2-8°C |
| solubility |
10% acetic acid in methanol: 1 mg/mL |
| form |
White solid |
| pka |
4.17±0.10(Predicted) |
| color |
Colorless needles |
| biological source |
synthetic |
| optical activity |
Optical rotation: -90.0 ± 5° (c = 0.5, MeOH, 20°C). |
| Water Solubility |
It is soluble in 10% (v/v) acetic acid in methanol (9:1 methanol:acetic acid) (1 mg/ml), ethanol (1-2 mg/ml with heat up to 60°C), DMSO (5 mg/ml), methanol (1 mg/ml), and acetic acid. Insoluble in benzene, chloroform, water, 1 M NaOH, and ether. |
| Specific Activity |
≥100,000U/mg |
| BRN |
2201362 |
| Sequence |
IsoValeryl-Val-Val-Sta-Ala-Sta-OH |
| Stability |
Stable. Incompatible with strong bases, strong acids. |
| InChIKey |
JKGWASGTXVCDML-LXTPJMTPSA-N |
| SMILES |
CC(C)C[C@H](NC(=O)[C@H](C)NC(=O)C[C@H](O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)CC(C)C)C(C)C)C(C)C)[C@@H](O)CC(O)=O |
| CAS DataBase Reference |
26305-03-3(CAS DataBase Reference) |