| Melting point |
250-260 °C(lit.) |
| storage temp. |
room temp |
| solubility |
Soluble in water; sparingly soluble in ethanol, ethylene glycol, methyl cellosolve |
| form |
Powder/Solid |
| Colour Index |
45005 |
| color |
Pink |
| Water Solubility |
Soluble in water. Also soluble in methyl cellosolve (9 mg/mL) and ethanol (3 mg/mL). |
| λmax |
548 nm |
| Merck |
13,8097 |
| BRN |
3795789 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Biological Applications |
Antimalarial agent; antiviral agent; nucleic acid sequencing; treating protozoan infections; herbicides |
| Major Application |
diagnostic assay manufacturing
hematology
histology |
| InChI |
1S/C17H19N2O.ClH/c1-18(2)14-7-5-12-9-13-6-8-15(19(3)4)11-17(13)20-16(12)10-14;/h5-11H,1-4H3;1H/q+1;/p-1 |
| InChIKey |
INCIMLINXXICKS-UHFFFAOYSA-M |
| SMILES |
[Cl-].CN(C)c1ccc2C=C3C=C\C(C=C3Oc2c1)=[N+](/C)C |
| CAS DataBase Reference |
92-32-0 |
| EPA Substance Registry System |
Pyronine Y (92-32-0) |
