PYRONIN Y
- Product NamePYRONIN Y
- CAS92-32-0
- MFC17H19ClN2O
- MW302.8
- EINECS202-147-8
- MOL File92-32-0.mol
Chemical Properties
| Melting point | 250-260 °C(lit.) |
| storage temp. | room temp |
| solubility | Soluble in water; sparingly soluble in ethanol, ethylene glycol, methyl cellosolve |
| form | Powder/Solid |
| Colour Index | 45005 |
| color | Pink |
| Water Solubility | Soluble in water. Also soluble in methyl cellosolve (9 mg/mL) and ethanol (3 mg/mL). |
| λmax | 548 nm |
| ex/em | λex 555 nm; λem 580 nm |
| Merck | 13,8097 |
| BRN | 3795789 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Biological Applications | Antimalarial agent; antiviral agent; nucleic acid sequencing; treating protozoan infections; herbicides |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C17H19N2O.ClH/c1-18(2)14-7-5-12-9-13-6-8-15(19(3)4)11-17(13)20-16(12)10-14;/h5-11H,1-4H3;1H/q+1;/p-1 |
| InChIKey | INCIMLINXXICKS-UHFFFAOYSA-M |
| SMILES | [Cl-].CN(C)c1ccc2C=C3C=C\C(C=C3Oc2c1)=[N+](/C)C |
| CAS DataBase Reference | 92-32-0 |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 68-36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| RTECS | BQ1450000 |
| TSCA | TSCA listed |
| HS Code | 32041300 |
| Storage Class | 11 - Combustible Solids |