| Melting point |
183-185 °C(lit.) |
| Boiling point |
330.68°C (rough estimate) |
| Density |
1.1444 (rough estimate) |
| refractive index |
1.5000 (estimate) |
| storage temp. |
room temp |
| solubility |
water: soluble10mg/mL, clear, colorless to faintly yellow |
| form |
White to off-white or colorless crystalline solid. |
| pka |
0.76±0.53(Predicted) |
| color |
White to Light yellow |
| Water Solubility |
water: soluble 10mg/mL, clear, colorless to faintly yellow |
| BRN |
1453764 |
| Cosmetics Ingredients Functions |
ANTIOXIDANT |
| InChI |
1S/C10H14N2O2/c1-10(2,3)12(14)8-9-4-6-11(13)7-5-9/h4-8H,1-3H3/b12-8+ |
| InChIKey |
RNRMWTCECDHNQU-XYOKQWHBSA-N |
| SMILES |
CC(C)(C)\[N+]([O-])=C/c1cc[n+]([O-])cc1 |
