| Melting point |
77-780C |
| alpha |
D20 -19.3° (c = 1 in methanol) |
| Boiling point |
672℃ |
| Density |
1.183±0.06 g/cm3(Predicted) |
| Flash point |
>110°(230°F) |
| storage temp. |
Inert atmosphere,Store in freezer, under -20°C |
| solubility |
H2O: 12 mg/mL, soluble |
| form |
solid |
| pka |
4.78±0.10(Predicted) |
| color |
white to tan |
| optical activity |
[α]/D -15.7 to -20°, c = 1 in methanol |
| Water Solubility |
Soluble in DMSO or methanol. Sparingly soluble in water |
| λmax |
222nm(EtOH)(lit.) |
| Merck |
14,6302 |
| Stability |
Stable for 1 year from date of purchase as supplied. Solutions in DMSO may be stored at -20°C for up to 1 month. |
| Major Application |
pharmaceutical |
| InChIKey |
MINDHVHHQZYEEK-HBBNESRFSA-N |
| SMILES |
[H][C@@]1(CO[C@@H](C\C(C)=C\C(=O)OCCCCCCCCC(O)=O)[C@H](O)[C@@H]1O)C[C@@H]2O[C@@]2([H])[C@@H](C)[C@H](C)O |
| CAS DataBase Reference |
12650-69-0(CAS DataBase Reference) |
