| Melting point |
204 °C (dec.) (lit.) |
| alpha |
-54.8o (C=5 IN CHLOROFORM) |
| Boiling point |
463.55°C (rough estimate) |
| Density |
1.1512 (rough estimate) |
| refractive index |
1.5500 (estimate) |
| storage temp. |
2-8°C |
| solubility |
Soluble in DMSO (up to 50 mg/ml with warming), in Ethanol (up to 10 mg/ml with warming) or in organic solvents such as Chloroform (up to 50 mg/ml) |
| form |
Solid |
| pka |
12.21±0.60(Predicted) |
| color |
White |
| Water Solubility |
11.86g/L(temperature not stated) |
| Merck |
13,6274 |
| BRN |
48732 |
| Stability |
Stable for 1 year from date of purchase as supplied. Solutions in DMSO or ethanol may be stored at -20°C for up to 1 month. |
| InChI |
1S/C16H23NO6/c1-9-13(18)23-11-5-7-17-6-4-10(12(11)17)8-22-14(19)16(3,21)15(9,2)20/h4,9,11-12,20-21H,5-8H2,1-3H3/t9-,11+,12+,15+,16-/m0/s1 |
| InChIKey |
QVCMHGGNRFRMAD-XFGHUUIASA-N |
| SMILES |
[H][C@@]12[C@H]3CCN1CC=C2COC(=O)[C@](C)(O)[C@](C)(O)[C@@H](C)C(=O)O3 |
| LogP |
-0.370 (est) |
| IARC |
2B (Vol. 10, Sup 7) 1987 |
| EPA Substance Registry System |
Monocrotaline (315-22-0) |
