| Melting point |
132-135 °C(lit.) |
| Boiling point |
373.9±42.0 °C(Predicted) |
| Density |
1.3380 (estimate) |
| vapor pressure |
0Pa at 25℃ |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
soluble in organic solvents such as ethanol, DMSO, and dimethyl formamide. The solubility of flufenamic acid in these solvents is approximately 11, 39, and 59 mg/ml, respectively. |
| pka |
pKa 3.9 (Uncertain);3.85 (Uncertain) |
| form |
Crystalline Powder or Chunks |
| color |
Off-white to gray-green |
| Water Solubility |
0.0265 g/L (37 ºC) |
| Merck |
14,4132 |
| BRN |
1996069 |
| Major Application |
forensics and toxicology
pharmaceutical (small molecule)
veterinary |
| InChI |
1S/C14H10F3NO2/c15-14(16,17)9-4-3-5-10(8-9)18-12-7-2-1-6-11(12)13(19)20/h1-8,18H,(H,19,20) |
| InChIKey |
LPEPZBJOKDYZAD-UHFFFAOYSA-N |
| SMILES |
OC(=O)c1ccccc1Nc2cccc(c2)C(F)(F)F |
| LogP |
5.25 |
| CAS DataBase Reference |
530-78-9(CAS DataBase Reference) |
| NIST Chemistry Reference |
Flufenamic acid(530-78-9) |
