| Melting point |
>255°C (dec.) |
| Boiling point |
546.5±50.0 °C(Predicted) |
| Density |
1.30±0.1 g/cm3(Predicted) |
| vapor pressure |
0Pa at 25℃ |
| storage temp. |
Amber Vial, -20°C Freezer |
| solubility |
Chloroform (Slightly, Heated, Sonicated), DMSO (Very Slightly, Heated) |
| Colour Index |
11680 |
| pka |
8.80±0.59(Predicted) |
| form |
solid |
| color |
Yellow to Dark Yellow |
| Stability |
Light Sensitive |
| Major Application |
cleaning products
cosmetics
food and beverages
personal care |
| Cosmetics Ingredients Functions |
COLORANT |
| InChI |
1S/C17H16N4O4/c1-11-8-9-14(15(10-11)21(24)25)19-20-16(12(2)22)17(23)18-13-6-4-3-5-7-13/h3-10,16H,1-2H3,(H,18,23)/b20-19+ |
| InChIKey |
MFYSUUPKMDJYPF-FMQUCBEESA-N |
| SMILES |
O=C(C(C(C)=O)/N=N/C1=CC=C(C)C=C1[N+]([O-])=O)NC2=CC=CC=C2 |
| LogP |
3.1 at 22.5℃ and pH6 |
| CAS DataBase Reference |
2512-29-0(CAS DataBase Reference) |
| EPA Substance Registry System |
C.I. Pigment Yellow 1 (2512-29-0) |
