Fast Yellow G
- Product NameFast Yellow G
- CAS2512-29-0
- CBNumberCB7232626
- MFC17H16N4O4
- MW340.33
- EINECS219-730-8
- MDL NumberMFCD00078234
- MOL File2512-29-0.mol
- MSDS FileSDS
Chemical Properties
| Melting point | >255°C (dec.) |
| Boiling point | 546.5±50.0 °C(Predicted) |
| Density | 1.30±0.1 g/cm3(Predicted) |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Amber Vial, -20°C Freezer |
| solubility | Chloroform (Slightly, Heated, Sonicated), DMSO (Very Slightly, Heated) |
| Colour Index | 11680 |
| pka | 8.80±0.59(Predicted) |
| form | solid |
| color | Yellow to Dark Yellow |
| Stability | Light Sensitive |
| Major Application | cleaning products cosmetics food and beverages personal care |
| Cosmetics Ingredients Functions | COLORANT |
| InChI | 1S/C17H16N4O4/c1-11-8-9-14(15(10-11)21(24)25)19-20-16(12(2)22)17(23)18-13-6-4-3-5-7-13/h3-10,16H,1-2H3,(H,18,23)/b20-19+ |
| InChIKey | MFYSUUPKMDJYPF-FMQUCBEESA-N |
| SMILES | O=C(C(C(C)=O)/N=N/C1=CC=C(C)C=C1[N+]([O-])=O)NC2=CC=CC=C2 |
| LogP | 3.1 at 22.5℃ and pH6 |
| CAS DataBase Reference | 2512-29-0(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P261-P272-P280-P302+P352+P333+P313+P363-P501 |
| Risk Statements | 20/21/22 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 3204.13.8000 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 2512-29-0(Hazardous Substances Data) |
