| Density |
1.78[at 20℃] |
| storage temp. |
room temp |
| solubility |
Methanol (Slightly), Water (Slightly) |
| form |
powder to crystal |
| Colour Index |
18965 |
| color |
Light yellow to Brown |
| Water Solubility |
120.46g/L at 20℃ |
| λmax |
400 nm |
| ε(extinction coefficient) |
≥8000 at 252-258nm in water at 0.02g/L |
| Major Application |
cleaning products cosmetics food and beverages personal care |
| Cosmetics Ingredients Functions |
COLORANT |
| InChIKey |
FTZLWXQKVFFWLY-LLIZZRELSA-L |
| SMILES |
[Na+].[Na+].CC1=NN(C(=O)C1\N=N\c2ccc(cc2)S([O-])(=O)=O)c3cc(Cl)c(cc3Cl)S([O-])(=O)=O |
| LogP |
-2.459 at 20℃ |
| CAS DataBase Reference |
6359-98-4 |
| EPA Substance Registry System |
C.I. Acid Yellow 17, disodium salt (6359-98-4) |