| Melting point |
260-262 °C (dec.)(lit.) |
| Density |
1.3739 (rough estimate) |
| bulk density |
340kg/m3 |
| refractive index |
1.6700 (estimate) |
| Flash point |
>100°C |
| storage temp. |
2-8°C |
| solubility |
H2O: 10 mg/mL, opaque, strongly red |
| form |
powder |
| color |
Red to dark purple |
| Odor |
Odorless solid |
| PH |
4.4 (20°C, 10g/L in H2O) |
| Water Solubility |
40 g/L (25 ºC) |
| λmax |
518 nm, 210 nm, 285 nm, 316 nm,
343 nm, 480 nm, 525 nm |
| Merck |
14,4731 |
| BRN |
3642536 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Biological Applications |
Nucleic acid hybridization; detecting nucleic acids,cells,cancer cells,human cytomegalovirus,hydrogenase A (hydA) of Clostridia,influenza A virus,oligonucleotides,viable Plesiomonas shigelloides; apoptosis assay; nucleic acid quantification |
| Major Application |
Electroluminescent displays;photoresists |
| InChI |
1S/C21H19N3.BrH/c1-2-24-20-13-16(23)9-11-18(20)17-10-8-15(22)12-19(17)21(24)14-6-4-3-5-7-14;/h3-13,23H,2,22H2,1H3;1H |
| InChIKey |
ZMMJGEGLRURXTF-UHFFFAOYSA-N |
| SMILES |
[Br-].CC[n+]1c(-c2ccccc2)c3cc(N)ccc3c4ccc(N)cc14 |
| CAS DataBase Reference |
1239-45-8(CAS DataBase Reference) |
| EPA Substance Registry System |
Phenanthridinium, 3,8-diamino-5-ethyl-6-phenyl-, bromide (1239-45-8) |
