| Melting point |
275 °C (dec.)(lit.) |
| bulk density |
680kg/m3 |
| storage temp. |
Store at +5°C to +30°C. |
| solubility |
spirit: soluble |
| Colour Index |
45400 |
| form |
Solid |
| color |
Very dark purple-red to dark brown |
| PH |
6.2 (10g/l, H2O, 25℃) |
| Water Solubility |
Soluble in water (390 g/L at 20°C), and ethanol. |
| λmax |
514 nm, 395 nm |
| Merck |
14,3602 |
| BRN |
4121964 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Biological Applications |
Antimalarial agent; protein assay; detecting enzyme activity; treating cancer,malaria,diabetes,a variety of conditions affecting skin,mouth,digestive tract,urinary tract,reproductive tract,respiratory tract,circulatory sys |
| Major Application |
diagnostic assay manufacturing
hematology
histology |
| InChI |
1S/C20H8Br2N2O9.2Na/c21-14-16(25)11(23(29)30)5-9-13(7-3-1-2-4-8(7)20(27)28)10-6-12(24(31)32)17(26)15(22)19(10)33-18(9)14;;/h1-6,25H,(H,27,28);;/q;2*+1/p-2 |
| InChIKey |
GYYTYUGGVBYJHE-UHFFFAOYSA-L |
| SMILES |
[Na+].[Na+].[O-]C(=O)c1ccccc1C2=C3C=C(C(=O)C(Br)=C3Oc4c(Br)c([O-])c(cc24)[N+]([O-])=O)[N+]([O-])=O |
| EPA Substance Registry System |
Eosin B (548-24-3) |
