| Melting point |
164°C |
| Density |
1.525[at 20℃] |
| vapor pressure |
0Pa at 25℃ |
| storage temp. |
Amber Vial, -20°C Freezer, Under inert atmosphere |
| solubility |
Very soluble in water; very slightly soluble in ethanol |
| form |
Crystalline Powder |
| Colour Index |
15510 |
| pka |
8.26, 11.4(at 25℃) |
| color |
Green to blue |
| Odor |
Odorless |
| PH Range |
Amber (7.4) to orange (8.6);Orange (10.2) to red (11.8) |
| Water Solubility |
116 g/L (30 ºC) |
| λmax |
483nm |
| ε(extinction coefficient) |
≥17000 at 480-486nm in water at 0.01g/L ≥26500 at 225-231nm in water at 0.01g/L ≥7500 at 307-313nm in water at 0.01g/L |
| Merck |
14,6858 |
| BRN |
3898201 |
| Stability |
Light Sensitive |
| Biological Applications |
Cosmetics; wound dressing materials |
| Major Application |
Organic light emitting diodes (OLEDs), nanoparticles, inks, wood preservatives, textiles, hair dyes, cosmetics, wound dressing materials, biofuel cells |
| Cosmetics Ingredients Functions |
COLORANT HAIR DYEING |
| InChI |
1S/C16H12N2O4S.Na/c19-15-10-5-11-3-1-2-4-14(11)16(15)18-17-12-6-8-13(9-7-12)23(20,21)22;/h1-10,19H,(H,20,21,22);/q;+1/p-1/b18-17+; |
| InChIKey |
CQPFMGBJSMSXLP-ZAGWXBKKSA-M |
| SMILES |
[Na+].Oc1ccc2ccccc2c1\N=N\c3ccc(cc3)S([O-])(=O)=O |
| LogP |
-0.95 at 20℃ |
| CAS DataBase Reference |
633-96-5(CAS DataBase Reference) |
| EPA Substance Registry System |
C.I. Acid Orange 7, monosodium salt (633-96-5) |