| Melting point |
>300°C |
| Density |
1.02 g/mL at 20 °C |
| bulk density |
710kg/m3 |
| vapor pressure |
0Pa at 25℃ |
| Flash point |
11 °C |
| storage temp. |
Store at RT. |
| solubility |
H2O: 0.1 g/mL, dark red |
| Colour Index |
45380 |
| form |
Solid |
| pka |
2.9, 4.5(at 25℃) |
| color |
Reddish |
| PH |
9.2 (10g/l, H2O, 20℃) |
| PH Range |
0(yellow)-3(green fluoresc.) |
| Water Solubility |
freely soluble |
| λmax |
514nm |
| Merck |
14,3603 |
| BRN |
3586809 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Biological Applications |
Treating age-related macular degeneration,burns,cancer,diabetes,obesity,dental bone defects,gastroesophageal reflux disease,prostate cancer,viral diseases; stents; wound-healing materials |
| Major Application |
Photovoltaic devices, color filter, nanoscale host material, detection of latent fingerprints, inks, detergents, hair dyes, cosmetics, implantable drug delivery devices, stents, diagnosis of breast lesions, labeling nucleic acids, detecting proteins, stress biomarkers, phosphoprotein, breast cancer metastases, antimicrobial agent, treatment of burns, endodontic, diabetes, obesity, cancer, radiochemotherapy, DNA sequencing, gene expression profiling, wound healing promoters |
| Cosmetics Ingredients Functions |
HAIR DYEING COLORANT |
| InChI |
1S/C20H8Br4O5.2Na/c21-11-5-9-13(7-3-1-2-4-8(7)20(27)28)10-6-12(22)17(26)15(24)19(10)29-18(9)14(23)16(11)25;;/h1-6,25H,(H,27,28);;/q;2*+1/p-2 |
| InChIKey |
SEACYXSIPDVVMV-UHFFFAOYSA-L |
| SMILES |
[Na+].[Na+].Brc1c2[o][c]3[c](c(c2cc([c]1=O)Br)c4c(cccc4)C(=O)[O-])=CC(=C(C=3Br)[O-])Br |
| LogP |
-1.33 |
| CAS DataBase Reference |
17372-87-1(CAS DataBase Reference) |
| EPA Substance Registry System |
Eosin Yellowish (YS) (17372-87-1) |