| Melting point |
>300°C |
| storage temp. |
Store at +15°C to +30°C. |
| solubility |
H2O: soluble1mg/mL |
| Colour Index |
45440 |
| form |
Solid |
| pka |
3.9, 4.7(at 25℃) |
| color |
Red-brown |
| Water Solubility |
soluble |
| Sensitive |
Light Sensitive |
| λmax |
548 nm |
| ε(extinction coefficient) |
≥90000 at 546-550nm at 0.008g/L |
| Merck |
14,8262 |
| BRN |
3645857 |
| Biological Applications |
Apoptosis assay; diagnosis of diseases related to amyloid accumulation; controlling plant diseases; identifying fungi; treating skin,mouth,digestive tract,urinary tract,reproductive tract,respiratory tract,circulatory system |
| Major Application |
diagnostic assay manufacturing
hematology
histology |
| InChI |
1S/C20H4Cl4I4O5.2Na/c21-10-8(9(20(31)32)11(22)13(24)12(10)23)7-3-1-5(25)16(29)14(27)18(3)33-19-4(7)2-6(26)17(30)15(19)28;;/h1-2,29H,(H,31,32);;/q;2*+1/p-2 |
| InChIKey |
UWBXIFCTIZXXLS-UHFFFAOYSA-L |
| SMILES |
[Na+].[Na+].[O-]C(=O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C2=C3C=C(I)C(=O)C(I)=C3Oc4c(I)c([O-])c(I)cc24 |
| CAS DataBase Reference |
632-69-9(CAS DataBase Reference) |
| EPA Substance Registry System |
Spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one, 4,5,6,7-tetrachloro-3',6'-dihydroxy-2',4',5',7'-tetraiodo-, disodium salt (632-69-9) |
