| Melting point |
<25 °C |
| Boiling point |
166-168 °C(lit.) |
| Density |
0.889 g/mL at 20 °C(lit.) |
| refractive index |
n20/D 1.503(lit.) |
| Flash point |
90°C |
| storage temp. |
2-8°C |
| solubility |
Chloroform (Slightly), Methanol (Slightly) |
| form |
Liquid |
| color |
Colourless |
| Odor |
at 100.00 %. woody |
| Odor Type |
woody |
| Merck |
14,4753 |
| BRN |
3240075 |
| Stability |
Light Sensitive |
| Major Application |
cleaning products
cosmetics
flavors and fragrances
food and beverages
personal care |
| InChI |
1S/C15H24/c1-13-7-5-8-14(2)10-12-15(3,4)11-6-9-13/h6-7,10-11H,5,8-9,12H2,1-4H3/b11-6+,13-7+,14-10+ |
| InChIKey |
FAMPSKZZVDUYOS-HRGUGZIWSA-N |
| SMILES |
C\C1=C/CC(C)(C)\C=C\C\C(C)=C\CC1 |
| LogP |
6.592 (est) |
| CAS DataBase Reference |
6753-98-6(CAS DataBase Reference) |
| EPA Substance Registry System |
1,4,8-Cycloundecatriene, 2,6,6,9-tetramethyl-, (1E,4E,8E)- (6753-98-6) |
