ALPHA-CARYOPHYLLENE
- Product NameALPHA-CARYOPHYLLENE
- CAS6753-98-6
- MFC15H24
- MW204.35
- EINECS229-816-7
- MOL File6753-98-6.mol
Chemical Properties
| Melting point | <25 °C |
| Boiling point | 166-168 °C(lit.) |
| Density | 0.889 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point | 90°C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Colourless |
| Odor | at 100.00 %. woody |
| Odor Type | woody |
| Merck | 14,4753 |
| BRN | 3240075 |
| Stability | Light Sensitive |
| Major Application | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| InChI | 1S/C15H24/c1-13-7-5-8-14(2)10-12-15(3,4)11-6-9-13/h6-7,10-11H,5,8-9,12H2,1-4H3/b11-6+,13-7+,14-10+ |
| InChIKey | FAMPSKZZVDUYOS-HRGUGZIWSA-N |
| SMILES | C\C1=C/CC(C)(C)\C=C\C\C(C)=C\CC1 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| RTECS | GZ4817500 |
| F | 10-23 |
| TSCA | TSCA listed |
| HS Code | 29021990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
