Tecnazene
- Product NameTecnazene
- CAS117-18-0
- MFC6HCl4NO2
- MW260.89
- EINECS204-178-2
- MOL File117-18-0.mol
Chemical Properties
| Melting point | 98-101 °C(lit.) |
| Boiling point | 304 °C(lit.) |
| Density | 1.744 g/cm3 (25 ºC) |
| refractive index | 1.6200 (estimate) |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Crystalline |
| color | White to Light yellow to Light orange |
| Water Solubility | 2.087mg/L(20 ºC) |
| BRN | 1973805 |
| Henry's Law Constant | 4.3×10-1 mol/(m3Pa) at 25℃, HSDB (2015) |
| Major Application | cleaning products cosmetics environmental flavors and fragrances food and beverages personal care pharmaceutical |
| InChI | 1S/C6HCl4NO2/c7-2-1-3(8)5(10)6(4(2)9)11(12)13/h1H |
| InChIKey | XQTLDIFVVHJORV-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1c(Cl)c(Cl)cc(Cl)c1Cl |
| EPA Substance Registry System | Tecnazene (117-18-0) |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 22-43-50/53 |
| Safety Statements | 24-37-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | DC0175000 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 |
| Hazardous Substances Data | 117-18-0(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: 7500mg/kg |
