(Methacryloxymethyl)methyldimethoxysilane
- Product Name(Methacryloxymethyl)methyldimethoxysilane
- CAS121177-93-3
- MFC8H16O4Si
- MW204.3
- EINECS
- MOL File121177-93-3.mol
Chemical Properties
| Melting point | <-100°C |
| Boiling point | 205°C |
| Density | 1,019 g/cm3 |
| refractive index | 1.4274 |
| Flash point | 88°C |
| storage temp. | Inert atmosphere,2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.020 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | InChI=1S/C8H16O4Si/c1-6(2)7(9)12-5-13-8(10-3)11-4/h8H,1,5,13H2,2-4H3 |
| InChIKey | SLRFSMGNUQIIOH-UHFFFAOYSA-N |
| SMILES | C(OC[SiH2]C(OC)OC)(=O)C(C)=C |
| EPA Substance Registry System | 2-Propenoic acid, 2-methyl-, (dimethoxymethylsilyl)methyl ester (121177-93-3) |
Safety Information
| Safety Statements | 23-24/25 |
| TSCA | TSCA listed |
| HS Code | 2931.90.9051 |