2-(Trimethylsiloxy)ethyl methacrylate
- Product Name2-(Trimethylsiloxy)ethyl methacrylate
- CAS17407-09-9
- MFC9H18O3Si
- MW202.32
- EINECS241-432-1
- MOL File17407-09-9.mol
Chemical Properties
| Boiling point | 65 °C |
| Density | 0.928 g/mL at 25 °C (lit.) |
| vapor pressure | <5 mm Hg ( 25 °C) |
| refractive index | n |
| Flash point | 170 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Difficult to mix. |
| form | clear liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 0.928 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C9H18O3Si/c1-8(2)9(10)11-6-7-12-13(3,4)5/h1,6-7H2,2-5H3 |
| InChIKey | WUGOQZFPNUYUOO-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCCO[Si](C)(C)C |
| CAS DataBase Reference | 17407-09-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |