3-(Methacryloyloxy)propyltris(trimethylsiloxy)silane
- Product Name3-(Methacryloyloxy)propyltris(trimethylsiloxy)silane
- CAS17096-07-0
- MFC16H38O5Si4
- MW422.81
- EINECS241-165-0
- MOL File17096-07-0.mol
Chemical Properties
| Melting point | <0°C |
| Boiling point | 112-115 °C0.2 mm Hg(lit.) |
| Density | 0.918 g/mL at 25 °C(lit.) |
| vapor pressure | <1 mm Hg ( 20 °C) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.918 |
| Water Solubility | Immiscible with water. |
| BRN | 1888727 |
| Cosmetics Ingredients Functions | FILM FORMING |
| InChI | 1S/C16H38O5Si4/c1-15(2)16(17)18-13-12-14-25(19-22(3,4)5,20-23(6,7)8)21-24(9,10)11/h1,12-14H2,2-11H3 |
| InChIKey | BESKSSIEODQWBP-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| LogP | 9 at 20℃ |
| CAS DataBase Reference | 17096-07-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10 |
| TSCA | No |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |