| Melting point |
-44°C |
| Boiling point |
187-188°C |
| Density |
0,767 g/cm3 |
| refractive index |
1.4230 |
| Flash point |
58°C |
| pka |
11.10±0.19(Predicted) |
| form |
clear liquid |
| color |
Colorless to Light yellow |
| Water Solubility |
Soluble in ethanol, ethyl ether and chloroform. Slightly soluble in water. |
| Merck |
14,3193 |
| BRN |
1719663 |
| Dielectric constant |
2.5(18℃) |
| InChI |
InChI=1S/C10H23N/c1-9(2)5-7-11-8-6-10(3)4/h9-11H,5-8H2,1-4H3 |
| InChIKey |
SPVVMXMTSODFPU-UHFFFAOYSA-N |
| SMILES |
C(NCCC(C)C)CC(C)C |
| CAS DataBase Reference |
544-00-3(CAS DataBase Reference) |
| EPA Substance Registry System |
1-Butanamine, 3-methyl-N-(3-methylbutyl)- (544-00-3) |
