| Melting point |
-115°C |
| Boiling point |
231 °C |
| Density |
0.844 |
| refractive index |
1.4330 |
| Flash point |
87°C |
| storage temp. |
Sealed in dry,Room Temperature |
| Specific Gravity |
0.844 |
| Appearance |
Colorless to light yellow Liquid |
| Water Solubility |
Not miscible or difficult to mix with water. |
| Hydrolytic Sensitivity |
1: no significant reaction with aqueous systems |
| BRN |
1750865 |
| InChI |
InChI=1S/C12H30OSi2/c1-7-14(8-2,9-3)13-15(10-4,11-5)12-6/h7-12H2,1-6H3 |
| InChIKey |
WILBTFWIBAOWLN-UHFFFAOYSA-N |
| SMILES |
[Si](CC)(CC)(CC)O[Si](CC)(CC)CC |
| CAS DataBase Reference |
994-49-0(CAS DataBase Reference) |
| EPA Substance Registry System |
Disiloxane, hexaethyl- (994-49-0) |
