Hexaphenyldisiloxane
- Product NameHexaphenyldisiloxane
- CAS1829-40-9
- MFC36H30OSi2
- MW534.79
- EINECS217-381-6
- MOL File1829-40-9.mol
Chemical Properties
| Melting point | ~225 °C |
| Boiling point | 494°C |
| Density | 1,2 g/cm3 |
| refractive index | 1.6800 |
| Flash point | >200°C |
| storage temp. | Storage temp. 2-8°C |
| form | powder to crystal |
| color | White to Almost white |
| Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems |
| BRN | 1334807 |
| InChI | 1S/C36H30OSi2/c1-7-19-31(20-8-1)38(32-21-9-2-10-22-32,33-23-11-3-12-24-33)37-39(34-25-13-4-14-26-34,35-27-15-5-16-28-35)36-29-17-6-18-30-36/h1-30H |
| InChIKey | IVZTVZJLMIHPEY-UHFFFAOYSA-N |
| SMILES | O([Si](c1ccccc1)(c2ccccc2)c3ccccc3)[Si](c4ccccc4)(c5ccccc5)c6ccccc6 |
| CAS DataBase Reference | 1829-40-9(CAS DataBase Reference) |
| EPA Substance Registry System | Disiloxane, hexaphenyl- (1829-40-9) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
