| Melting point |
-89°C |
| Boiling point |
155 °C |
| Density |
0.976 |
| refractive index |
1.52 |
| Flash point |
156°C |
| storage temp. |
2-8°C |
| form |
liquid |
| Specific Gravity |
0.976 |
| color |
Colorless to Almost colorless |
| Hydrolytic Sensitivity |
1: no significant reaction with aqueous systems |
| λmax |
259nm(Cyclohexane)(lit.) |
| InChI |
InChI=1S/C16H22OSi2/c1-18(2,15-11-7-5-8-12-15)17-19(3,4)16-13-9-6-10-14-16/h5-14H,1-4H3 |
| InChIKey |
YQJPWWLJDNCSCN-UHFFFAOYSA-N |
| SMILES |
[Si](C)(C)(C1=CC=CC=C1)O[Si](C)(C)C1=CC=CC=C1 |
| CAS DataBase Reference |
56-33-7(CAS DataBase Reference) |
| EPA Substance Registry System |
Disiloxane, 1,1,3,3-tetramethyl-1,3-diphenyl- (56-33-7) |
