| Melting point |
<0°C |
| Boiling point |
137 °C(lit.) |
| Density |
1.575 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.428(lit.) |
| Flash point |
18 °C |
| storage temp. |
2-8°C, sealed storage, away from moisture |
| form |
liquid |
| Specific Gravity |
1.575 |
| Appearance |
Colorless to light yellow Liquid |
| Hydrolytic Sensitivity |
8: reacts rapidly with moisture, water, protic solvents |
| InChI |
InChI=1S/Cl6OSi2/c1-8(2,3)7-9(4,5)6 |
| InChIKey |
QHAHOIWVGZZELU-UHFFFAOYSA-N |
| SMILES |
[Si](Cl)(Cl)(Cl)O[Si](Cl)(Cl)Cl |
| CAS DataBase Reference |
14986-21-1(CAS DataBase Reference) |
| EPA Substance Registry System |
Disiloxane, hexachloro- (14986-21-1) |
