TETRAKIS(TRIMETHYLSILOXY)SILANE
- Product NameTETRAKIS(TRIMETHYLSILOXY)SILANE
- CAS3555-47-3
- MFC12H36O4Si5
- MW384.84
- EINECS222-613-4
- MOL File3555-47-3.mol
Chemical Properties
| Melting point | -60 °C |
| Boiling point | 103-106 °C/2 mmHg (lit.) |
| Density | 0.87 g/mL at 25 °C (lit.) |
| vapor pressure | 27.4hPa at 20℃ |
| refractive index | n |
| Flash point | 169 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | liquid |
| Specific Gravity | 0.868 |
| color | Colorless to Almost colorless |
| Water Solubility | 150.7ng/L at 23℃ |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| BRN | 1793898 |
| Henry's Law Constant | 2.6×10-8 mol/(m3Pa) at 25℃, Ebert et al. (2023) |
| InChI | 1S/C12H36O4Si5/c1-17(2,3)13-21(14-18(4,5)6,15-19(7,8)9)16-20(10,11)12/h1-12H3 |
| InChIKey | VNRWTCZXQWOWIG-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)O[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| LogP | 9 at 25℃ |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NA1993 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | CBL |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
